logo
Home  > Methyl 5-(bromomethyl)-2-nitrobenzoate

AC09563

88071-91-4 | Methyl 5-(bromomethyl)-2-nitrobenzoate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $24.00 $17.00 -   +
1g 95% in stock $48.00 $34.00 -   +
5g 95% in stock $171.00 $120.00 -   +
25g 95% in stock $599.00 $419.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AC09563
Chemical Name: Methyl 5-(bromomethyl)-2-nitrobenzoate
CAS Number: 88071-91-4
Molecular Formula: C9H8BrNO4
Molecular Weight: 274.0681
MDL Number: MFCD20528191
SMILES: COC(=O)c1cc(CBr)ccc1[N+](=O)[O-]

 

Upstream Synthesis Route
  • The application of Benzoic acid, 5-(bromomethyl)-2-nitro-, methyl ester in chemical synthesis is significant in the field of organic chemistry. This compound serves as a versatile building block for the synthesis of various complex molecules due to its unique structural properties. Its bromomethyl and nitro functional groups provide opportunities for selective chemical transformations, allowing chemists to introduce specific functionalities at precise positions in a molecule. This enables the synthesis of diverse compounds with tailored properties, making it valuable in the development of pharmaceuticals, agrochemicals, and materials science. By leveraging the reactivity of Benzoic acid, 5-(bromomethyl)-2-nitro-, methyl ester, chemists can access a wide range of chemical reactions to create novel molecular structures with desired characteristics.
FEATURED PRODUCTS