AH85464
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $35.00 | $25.00 | - + | |
2mg | 98% | in stock | $52.00 | $36.00 | - + | |
5mg | 98% | in stock | $86.00 | $60.00 | - + | |
10mg | 98% | in stock | $128.00 | $90.00 | - + | |
25mg | 95% | in stock | $203.00 | $142.00 | - + | |
100mg | 95% | in stock | $546.00 | $382.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85464 |
Chemical Name: | AMG-47a |
CAS Number: | 882663-88-9 |
Molecular Formula: | C29H28F3N5O2 |
Molecular Weight: | 535.5601 |
MDL Number: | MFCD09970318 |
SMILES: | Cc1ccc(cc1c1ccc2c(c1)cnc(n2)NCCN1CCOCC1)C(=O)Nc1cccc(c1)C(F)(F)F |
Complexity: | 795 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 39 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 5.2 |
Bioorganic & medicinal chemistry letters 20130801
Journal of medicinal chemistry 20060921
Journal of bacteriology 19760101