AB43513
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $6.00 | $4.00 | - + | |
1g | 95% | in stock | $20.00 | $14.00 | - + | |
5g | ≥95% | in stock | $36.00 | $25.00 | - + | |
10g | 95% | in stock | $54.00 | $38.00 | - + | |
25g | ≥95% | in stock | $115.00 | $80.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43513 |
Chemical Name: | 2-(Trimethylsilyl)phenyl trifluoromethanesulfonate |
CAS Number: | 88284-48-4 |
Molecular Formula: | C10H13F3O3SSi |
Molecular Weight: | 298.3541 |
MDL Number: | MFCD00799598 |
SMILES: | O=S(=O)(C(F)(F)F)Oc1ccccc1[Si](C)(C)C |
Complexity: | 381 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 3 |
Chemical communications (Cambridge, England) 20121121
Organic letters 20110715
Carbohydrate research 20110601
Chemical communications (Cambridge, England) 20110528
The Journal of organic chemistry 20091120