AC12324
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | in stock | $6.00 | $4.00 | - + | ||
1g | in stock | $7.00 | $5.00 | - + | ||
5g | in stock | $13.00 | $9.00 | - + | ||
10g | in stock | $24.00 | $17.00 | - + | ||
25g | in stock | $46.00 | $33.00 | - + | ||
100g | in stock | $139.00 | $98.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC12324 |
Chemical Name: | Methyl 3,5-dimethoxy-4-hydroxybenzoate |
CAS Number: | 884-35-5 |
Molecular Formula: | C10H12O5 |
Molecular Weight: | 212.1993 |
MDL Number: | MFCD00017199 |
SMILES: | COC(=O)c1cc(OC)c(c(c1)OC)O |
NSC Number: | 611398 |
Complexity: | 204 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.4 |
Benzoic acid, 4-hydroxy-3,5-dimethoxy-, methyl ester serves as a valuable reagent in chemical synthesis, particularly in the field of medicinal chemistry and drug development. This compound is commonly utilized in the synthesis of various pharmaceutical intermediates and active ingredients due to its versatile chemical properties. Its ability to undergo selective functional group transformations makes it a crucial building block in the creation of complex organic molecules. Researchers often rely on this compound for the introduction of specific functional groups or structural motifs into target molecules, enabling the efficient synthesis of novel drug candidates and bioactive compounds. Facilitating precise modifications and unique structural arrangements, Benzoic acid, 4-hydroxy-3,5-dimethoxy-, methyl ester plays a pivotal role in advancing synthetic strategies and expanding the chemical toolbox available to chemists working in the pharmaceutical industry.
Food chemistry 20121201
Bioresource technology 20121101
Journal of agricultural and food chemistry 20120725
Analytica chimica acta 20120630
Journal of agricultural and food chemistry 20120404
International journal of food microbiology 20120215
Biotechnology progress 20120101
Bioresource technology 20110601
Chemistry & biodiversity 20110401
Applied microbiology and biotechnology 20110301
International journal of molecular sciences 20110101
Journal of natural products 20101129
Molecules (Basel, Switzerland) 20100909
Journal of agricultural and food chemistry 20100428
Molecules (Basel, Switzerland) 20100422
Water research 20100401
Molecules (Basel, Switzerland) 20090727
Journal of agricultural and food chemistry 20090513
European journal of pharmacology 20090417
BMC complementary and alternative medicine 20090101
Chemistry and physics of lipids 20071201
Biochemistry. Biokhimiia 20060501
Zhong yao cai = Zhongyaocai = Journal of Chinese medicinal materials 20060401
Biotechnology and bioengineering 20051005
Acta crystallographica. Section D, Biological crystallography 20050201
Phytochemistry 20030701
Applied biochemistry and biotechnology 20010801