AW33567
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $45.00 | $32.00 | - + | |
1g | 98% | in stock | $133.00 | $93.00 | - + | |
5g | 98% | in stock | $491.00 | $344.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AW33567 |
Chemical Name: | tert-butyl 3-methyl-4-oxopyrrolidine-1-carboxylate |
CAS Number: | 885102-34-1 |
Molecular Formula: | C10H17NO3 |
Molecular Weight: | 199.2469 |
MDL Number: | MFCD29918272 |
SMILES: | O=C1CN(CC1C)C(=O)OC(C)(C)C |
The tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is a versatile compound that finds significant application in chemical synthesis. This compound serves as a key reagent in the preparation of various organic molecules due to its unique structural properties. The presence of the tert-butyl group provides steric hindrance, making it a useful building block for the synthesis of complex molecules with specific stereochemical requirements. Additionally, the 3-methyl-4-oxopyrrolidine-1-carboxylate moiety offers reactivity that allows for efficient functional group transformations, making it a valuable tool for organic chemists conducting diverse synthetic transformations. Its role in mediating key reactions and facilitating the formation of new chemical bonds makes tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate a crucial component in the arsenal of synthetic chemists.