AB46544
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $7.00 | $5.00 | - + | |
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $33.00 | $23.00 | - + | |
100g | 97% | in stock | $626.00 | $438.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46544 |
Chemical Name: | 6-Bromo-4-indazolecarboxylic acid methyl ester |
CAS Number: | 885518-49-0 |
Molecular Formula: | C9H7BrN2O2 |
Molecular Weight: | 255.0681 |
MDL Number: | MFCD07781319 |
SMILES: | COC(=O)c1cc(Br)cc2c1cn[nH]2 |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.1 |
Methyl 6-Bromo-1H-indazole-4-carboxylate is a versatile compound commonly used in chemical synthesis as a key building block for the creation of various indazole derivatives. With its unique structure and reactivity, this compound serves as a valuable intermediate in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. Its presence enables the modification of indazole structure, allowing for the development of new compounds with tailored properties and functions. Through strategic transformations in organic synthesis, Methyl 6-Bromo-1H-indazole-4-carboxylate plays a crucial role in the efficient and precise production of advanced compounds for a wide range of applications in the field of chemistry.