AC03526
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $6.00 | $4.00 | - + | |
250mg | 95% | in stock | $6.00 | $5.00 | - + | |
1g | 95% | in stock | $24.00 | $17.00 | - + | |
5g | 95% | in stock | $109.00 | $76.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC03526 |
Chemical Name: | 3-Bromo-1h-indazole-5-carboxylic acid |
CAS Number: | 885521-49-3 |
Molecular Formula: | C8H5BrN2O2 |
Molecular Weight: | 241.0415 |
MDL Number: | MFCD07781587 |
SMILES: | OC(=O)c1cc2c(Br)n[nH]c2cc1 |
Complexity: | 224 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.1 |
3-Bromo-1H-indazole-5-carboxylic acid is a versatile compound commonly utilized in chemical synthesis for its distinctive chemical reactivity and functionality. One key application of this compound lies in its ability to serve as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and materials. In organic synthesis, 3-Bromo-1H-indazole-5-carboxylic acid acts as a crucial intermediate, facilitating the construction of complex molecular structures through sequential reactions, such as coupling reactions, cyclization, and functional group transformations. This compound's unique structural properties make it a desirable candidate for the design and synthesis of novel active pharmaceutical ingredients (APIs) and bioactive molecules with potential therapeutic applications. Additionally, its compatibility with a wide range of synthetic methodologies and functional group manipulations further enhances its utility in the development of diverse chemical compounds for various industrial purposes.