AC01522
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 95% | 2 weeks | $254.00 | $178.00 | - + | |
25mg | 95%+ | 2 weeks | $344.00 | $241.00 | - + | |
50mg | 95%+ | 2 weeks | $564.00 | $395.00 | - + | |
100mg | 95%+ | 2 weeks | $839.00 | $587.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC01522 |
Chemical Name: | 3-Quinolinecarboxylic acid, 7-chloro-6-fluoro-1,4-dihydro-4-oxo- |
CAS Number: | 88569-32-8 |
Molecular Formula: | C10H5ClFNO3 |
Molecular Weight: | 241.6030 |
MDL Number: | MFCD04041241 |
SMILES: | OC(=O)c1c[nH]c2c(c1=O)cc(c(c2)Cl)F |
Complexity: | 371 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.6 |
European journal of medicinal chemistry 20120501