AB43820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $6.00 | $5.00 | - + | |
5g | 97% | in stock | $30.00 | $21.00 | - + | |
10g | 97% | in stock | $55.00 | $38.00 | - + | |
25g | 97% | in stock | $69.00 | $48.00 | - + | |
100g | 97% | in stock | $201.00 | $141.00 | - + | |
500g | 97% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43820 |
Chemical Name: | 2-Anilino-6-dibutylamino-3-methylfluoran |
CAS Number: | 89331-94-2 |
Molecular Formula: | C35H36N2O3 |
Molecular Weight: | 532.6719 |
MDL Number: | MFCD00307579 |
SMILES: | CCCCN(c1ccc2c(c1)Oc1c(C32OC(=O)c2c3cccc2)cc(c(c1)C)Nc1ccccc1)CCCC |
Complexity: | 837 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 9 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 8.7 |
Journal of environmental sciences (China) 20070101