AB65914
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $55.00 | $38.00 | - + | |
1g | 95% | in stock | $78.00 | $54.00 | - + | |
5g | 95% | in stock | $160.00 | $112.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB65914 |
Chemical Name: | tert-Butyl 2-chloro-3-formylpyridin-4-ylcarbamate |
CAS Number: | 893423-62-6 |
Molecular Formula: | C11H13ClN2O3 |
Molecular Weight: | 256.6855 |
MDL Number: | MFCD16659013 |
SMILES: | O=Cc1c(ccnc1Cl)NC(=O)OC(C)(C)C |
Complexity: | 291 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.4 |
The tert-Butyl (2-chloro-3-formylpyridin-4-yl)carbamate is a versatile compound employed in chemical synthesis for various applications. Its unique structure and reactivity make it a valuable reagent in organic chemistry. In chemical synthesis, this compound serves as a key building block for the preparation of various heterocyclic compounds, pharmaceutical intermediates, and agrochemicals. The presence of the 2-chloro-3-formylpyridine moiety allows for facile derivatization and functional group manipulation, enabling the synthesis of complex molecules with precision and efficiency. By incorporating tert-Butyl (2-chloro-3-formylpyridin-4-yl)carbamate into synthesis pathways, chemists can access a diverse array of compounds with potential biological activity and industrial utility. Its strategic use in chemical transformations underscores its significance as a valuable tool in the synthetic chemist's arsenal.