AH85316
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $19.00 | $14.00 | - + | |
5mg | 98+% | in stock | $46.00 | $33.00 | - + | |
250mg | 98 | in stock | $2,132.00 | $1,492.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85316 |
Chemical Name: | N-Benzyl-2-(5-(4-(2-morpholinoethoxy)phenyl)pyridin-2-yl)acetamide |
CAS Number: | 897016-82-9 |
Molecular Formula: | C26H29N3O3 |
Molecular Weight: | 431.5268 |
MDL Number: | MFCD18633218 |
SMILES: | O=C(Cc1ccc(cn1)c1ccc(cc1)OCCN1CCOCC1)NCc1ccccc1 |
Complexity: | 540 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 9 |
XLogP3: | 2.9 |
Journal of medicinal chemistry 20180614
Investigational new drugs 20130801
Breast cancer research and treatment 20120401
European journal of medicinal chemistry 20111001
Bioorganic & medicinal chemistry 20110415
Journal of medicinal chemistry 20100211
Digestive diseases and sciences 20090701