AD18059
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $15.00 | $10.00 | - + | |
10g | 97% | in stock | $16.00 | $11.00 | - + | |
25g | 97% | in stock | $22.00 | $15.00 | - + | |
100g | 97% | in stock | $69.00 | $48.00 | - + | |
500g | 97% | in stock | $319.00 | $223.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD18059 |
Chemical Name: | 4-Bromobenzophenone |
CAS Number: | 90-90-4 |
Molecular Formula: | C13H9BrO |
Molecular Weight: | 261.114 |
MDL Number: | MFCD00000103 |
SMILES: | Brc1ccc(cc1)C(=O)c1ccccc1 |
NSC Number: | 59863 |
Complexity: | 213 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.1 |
Acta crystallographica. Section E, Structure reports online 20080201
Acta crystallographica. Section B, Structural science 20070401
The Journal of organic chemistry 20060120
Analytical chemistry 20040315