AB42981
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $4.00 | - + | |
10g | 98% | in stock | $7.00 | $5.00 | - + | |
25g | 98% | in stock | $15.00 | $11.00 | - + | |
100g | 98% | in stock | $47.00 | $33.00 | - + | |
500g | 98% | in stock | $137.00 | $96.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42981 |
Chemical Name: | (S)-4-Benzyl-2-oxazolidinone |
CAS Number: | 90719-32-7 |
Molecular Formula: | C10H11NO2 |
Molecular Weight: | 177.1998 |
MDL Number: | MFCD00064496 |
SMILES: | O=C1OC[C@@H](N1)Cc1ccccc1 |
Complexity: | 187 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.7 |
Nature chemistry 20120201
The Journal of organic chemistry 20020308