AI67800
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | ≥95% (a mixture of A, B, C) | in stock | $130.00 | $91.00 | - + | |
10mg | ≥95% (a mixture of A, B, C) | in stock | $245.00 | $171.00 | - + | |
25mg | ≥95% (a mixture of A, B, C) | in stock | $547.00 | $383.00 | - + | |
50mg | ≥95% (a mixture of A, B, C) | in stock | $1,024.00 | $717.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI67800 |
Chemical Name: | Chymostatin |
CAS Number: | 9076-44-2 |
Molecular Formula: | C31H41N7O6 |
Molecular Weight: | 607.7005 |
MDL Number: | MFCD00071059 |
SMILES: | O=CC(NC(=O)C(NC(=O)C(C1CCN=C(N1)N)NC(=O)NC(C(=O)O)Cc1ccccc1)CC(C)C)Cc1ccccc1 |