AI61039
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
10g | 95% | in stock | $20.00 | $14.00 | - + | |
25g | 95% | in stock | $40.00 | $28.00 | - + | |
50g | 95% | in stock | $68.00 | $48.00 | - + | |
100g | 95% | in stock | $115.00 | $81.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI61039 |
Chemical Name: | (S)-N-Boc-2-pyrrolidone-5-carboxylic acid t-butyl ester |
CAS Number: | 91229-91-3 |
Molecular Formula: | C14H23NO5 |
Molecular Weight: | 285.3361 |
MDL Number: | MFCD03094770 |
SMILES: | O=C([C@@H]1CCC(=O)N1C(=O)OC(C)(C)C)OC(C)(C)C |
Complexity: | 416 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.9 |
The Journal of organic chemistry 20080919