AB56267
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $38.00 | $27.00 | - + | |
5g | 98% | in stock | $115.00 | $81.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB56267 |
Chemical Name: | [1,1'-Bis(di-cyclohexylphosphino)ferrocene]dichloropalladium(II) |
CAS Number: | 917511-90-1 |
Molecular Formula: | C34H46Cl2FeP2Pd |
Molecular Weight: | 749.8475620000007 |
MDL Number: | MFCD11656081 |
SMILES: | [Cl-][Pd+2]1([Cl-])P(C2CCCCC2)(C2CCCCC2)[C-]23C4=C5[Fe+2]6789%1034([C-]3(P1(C1CCCCC1)C1CCCCC1)C6=C9C%10=C73)C2=C58 |
Complexity: | 217 |
Covalently-Bonded Unit Count: | 4 |
Heavy Atom Count: | 40 |
Rotatable Bond Count: | 6 |
1,1'-Bis(di-cyclohexylphosphino)ferrocene]dichloropalladium(II) is a versatile and powerful catalyst used in various chemical synthesis reactions. This organometallic complex is known for its ability to facilitate a wide range of organic transformations with high efficiency and selectivity. In synthetic chemistry, this compound plays a crucial role in catalyzing cross-coupling reactions, including Suzuki-Miyaura, Heck, and Sonogashira reactions, among others. It acts as a key mediator in forming C-C and C-heteroatom bonds, allowing for the precise construction of complex organic molecules. The unique structure of [1,1'-Bis(di-cyclohexylphosphino)ferrocene]dichloropalladium(II) provides a stable platform for promoting these transformations, leading to improved yields and reduced reaction times in the synthesis of pharmaceuticals, agrochemicals, and materials science. Its exceptional catalytic properties make it an indispensable tool for modern organic chemists striving to streamline their synthetic routes and access novel molecular architectures.