AH82081
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $6.00 | $4.00 | - + | |
5mg | 98% | in stock | $11.00 | $8.00 | - + | |
10mg | 98% | in stock | $13.00 | $9.00 | - + | |
25mg | 98% | in stock | $29.00 | $20.00 | - + | |
100mg | 98% | in stock | $68.00 | $48.00 | - + | |
250mg | 98% | in stock | $168.00 | $118.00 | - + | |
1g | 97% | in stock | $511.00 | $358.00 | - + | |
5g | 98% | in stock | $946.00 | $663.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH82081 |
Chemical Name: | 5-Carboxytetramethylrhodamine |
CAS Number: | 91809-66-4 |
Molecular Formula: | C25H22N2O5 |
Molecular Weight: | 430.4526 |
MDL Number: | MFCD00269769 |
SMILES: | CN(c1ccc2c(c1)[o+]c1c(c2c2ccc(cc2C(=O)O)C(=O)[O-])ccc(c1)N(C)C)C |
Complexity: | 875 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.2 |
Bioorganic & medicinal chemistry 20111215
Physical chemistry chemical physics : PCCP 20110814
Nan fang yi ke da xue xue bao = Journal of Southern Medical University 20110201
PloS one 20110101
European journal of immunology 20071201
Biophysical journal 20051101
Biochemistry 20020820
Journal of biotechnology 20020101
Bioorganic & medicinal chemistry 20011001