AB48524
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $11.00 | $8.00 | - + | |
10g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $23.00 | $17.00 | - + | |
100g | 98% | in stock | $63.00 | $45.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48524 |
Chemical Name: | 2-(Trifluoromethyl)phenothiazine |
CAS Number: | 92-30-8 |
Molecular Formula: | C13H8F3NS |
Molecular Weight: | 267.2695 |
MDL Number: | MFCD00005018 |
SMILES: | FC(c1ccc2c(c1)Nc1c(S2)cccc1)(F)F |
NSC Number: | 50438 |
Complexity: | 307 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 5 |
European journal of medicinal chemistry 20090601