logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Other Aromatic Heterocycles  > 4-Chloro-1h-pyrrolo[2,3-b]pyridine-5-carboxylic acid

AH85117

920966-03-6 | 4-Chloro-1h-pyrrolo[2,3-b]pyridine-5-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $34.00 $24.00 -   +
250mg 97% in stock $54.00 $38.00 -   +
1g 97% in stock $109.00 $76.00 -   +
5g 97% in stock $379.00 $265.00 -   +
10g 97% in stock $741.00 $519.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AH85117
Chemical Name: 4-Chloro-1h-pyrrolo[2,3-b]pyridine-5-carboxylic acid
CAS Number: 920966-03-6
Molecular Formula: C8H5ClN2O2
Molecular Weight: 196.5905
MDL Number: MFCD10574983
SMILES: OC(=O)c1cnc2c(c1Cl)cc[nH]2

 

Upstream Synthesis Route 
  • 4-Chloro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a valuable chemical compound widely utilized in organic synthesis processes. Its application in chemical synthesis primarily revolves around its ability to serve as a key building block in the preparation of various pharmaceuticals and agrochemicals. This compound plays a crucial role as a versatile intermediate, enabling the synthesis of complex molecules with diverse biological activities. Its unique structure and reactivity make it an essential component in the development of novel drug candidates and specialized chemical compounds. Additionally, its presence in the molecular structure imparts specific properties that enhance the efficacy and performance of the final products in which it is incorporated.
FEATURED PRODUCTS