AH85581
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $38.00 | $27.00 | - + | |
5mg | 99+% | in stock | $142.00 | $100.00 | - + | |
10mg | 99+% | in stock | $184.00 | $129.00 | - + | |
50mg | 99+% | in stock | $310.00 | $217.00 | - + | |
1000mg | 98% by HPLC | in stock | $5,922.00 | $4,145.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85581 |
Chemical Name: | KU-60019 |
CAS Number: | 925701-46-8 |
Molecular Formula: | C30H33N3O5S |
Molecular Weight: | 547.6651 |
MDL Number: | MFCD18384974 |
SMILES: | O=C(Nc1ccc2c(c1)Cc1c(S2)c(ccc1)c1cc(=O)cc(o1)N1CCOCC1)CN1CC(C)OC(C1)C |
Complexity: | 972 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 39 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.5 |
Environmental health perspectives 20160101
Bioorganic & medicinal chemistry letters 20130801
The Journal of biological chemistry 20120406
Cell cycle (Georgetown, Tex.) 20120315
Molecular cancer therapeutics 20091001