logo
Home  > Clofilium tosylate

AB45759

92953-10-1 | Clofilium tosylate

Packsize Purity Availability Price Discounted Price    Quantity
25mg 97% in stock $236.00 $165.00 -   +
50mg 97% in stock $400.00 $280.00 -   +
100mg 97% in stock $682.00 $477.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB45759
Chemical Name: Clofilium tosylate
CAS Number: 92953-10-1
Molecular Formula: C28H44ClNO3S
Molecular Weight: 510.1719
MDL Number: MFCD00069233
SMILES: Cc1ccc(cc1)S(=O)(=O)[O-].CCCCCCC[N+](CCCCc1ccc(cc1)Cl)(CC)CC

 

Upstream Synthesis Route 
  • Clofilium tosylate is a potent chemical compound that plays a crucial role in chemical synthesis applications. This unique compound is utilized as a versatile reagent in organic chemistry due to its ability to act as a selective potassium channel blocker. When incorporated into chemical synthesis processes, Clofilium tosylate serves as a valuable tool for manipulating and controlling ion flow, facilitating the creation of complex molecular structures. Its selective potassium channel blocking properties make it particularly useful in the development of novel pharmaceuticals and other specialized organic compounds. Additionally, Clofilium tosylate's high purity and stability make it a reliable and efficient reagent for various chemical synthesis applications.
FEATURED PRODUCTS