AH85381
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $16.00 | $11.00 | - + | |
5mg | 99% | in stock | $33.00 | $23.00 | - + | |
10mg | 99% | in stock | $40.00 | $28.00 | - + | |
25mg | 99% | in stock | $48.00 | $34.00 | - + | |
50mg | 99% | in stock | $82.00 | $57.00 | - + | |
100mg | 99% | in stock | $138.00 | $97.00 | - + | |
250mg | 99% | in stock | $234.00 | $164.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85381 |
Chemical Name: | Ppq-102 |
CAS Number: | 931706-15-9 |
Molecular Formula: | C26H22N4O3 |
Molecular Weight: | 438.4778799999999 |
MDL Number: | MFCD14824240 |
SMILES: | Cc1ccc(o1)C1Nc2ccccc2-n2c1c1c(c2c2ccccc2)c(=O)n(c(=O)n1C)C |
Complexity: | 786 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 33 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 3.7 |
Journal of medicinal chemistry 20110811
Bioorganic & medicinal chemistry letters 20100301
Journal of medicinal chemistry 20091022