logo
Home  > 3-Aza-bicyclo[3.1.0]hexane-3-carboxylic acid tert-butyl ester

AJ19659

936551-50-7 | 3-Aza-bicyclo[3.1.0]hexane-3-carboxylic acid tert-butyl ester

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $90.00 $63.00 -   +
1g 95% in stock $113.00 $79.00 -   +
5g 95% in stock $319.00 $224.00 -   +
10g 95% in stock $510.00 $357.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AJ19659
Chemical Name: 3-Aza-bicyclo[3.1.0]hexane-3-carboxylic acid tert-butyl ester
CAS Number: 936551-50-7
Molecular Formula: C10H17NO2
Molecular Weight: 183.2475
MDL Number: MFCD14525732
SMILES: O=C(N1CC2C(C1)C2)OC(C)(C)C

 

Upstream Synthesis Route 
  • Tert-Butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate is a versatile compound with significant applications in chemical synthesis. As a key building block, it serves as a valuable precursor in the preparation of various pharmaceuticals and agrochemicals. Its unique structure allows for the introduction of functional groups at specific positions, enabling the synthesis of complex molecules with high efficiency and selectivity. Additionally, its presence can enhance the stereochemical control of reactions, leading to the production of chiral compounds that are crucial in the development of new materials and bioactive substances. In summary, tert-Butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate plays a pivotal role in the synthesis of diverse compounds with important applications in the fields of medicine, agriculture, and materials science.
FEATURED PRODUCTS