AJ19659
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $89.00 | $62.00 | - + | |
1g | 95% | in stock | $113.00 | $79.00 | - + | |
5g | 95% | in stock | $319.00 | $224.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AJ19659 |
Chemical Name: | 3-Aza-bicyclo[3.1.0]hexane-3-carboxylic acid tert-butyl ester |
CAS Number: | 936551-50-7 |
Molecular Formula: | C10H17NO2 |
Molecular Weight: | 183.24747999999994 |
MDL Number: | MFCD14525732 |
SMILES: | O=C(N1CC2C(C1)C2)OC(C)(C)C |
Tert-Butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate is a versatile compound with significant applications in chemical synthesis. As a key building block, it serves as a valuable precursor in the preparation of various pharmaceuticals and agrochemicals. Its unique structure allows for the introduction of functional groups at specific positions, enabling the synthesis of complex molecules with high efficiency and selectivity. Additionally, its presence can enhance the stereochemical control of reactions, leading to the production of chiral compounds that are crucial in the development of new materials and bioactive substances. In summary, tert-Butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate plays a pivotal role in the synthesis of diverse compounds with important applications in the fields of medicine, agriculture, and materials science.