AB57715
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $179.00 | $125.00 | - + | |
250mg | 95% | in stock | $259.00 | $181.00 | - + | |
1g | 95% | in stock | $558.00 | $391.00 | - + | |
5g | 95% | in stock | $1,179.00 | $825.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57715 |
Chemical Name: | tert-Butyl undec-10-enoate |
CAS Number: | 93757-41-6 |
Molecular Formula: | C15H28O2 |
Molecular Weight: | 240.3816 |
MDL Number: | MFCD26383631 |
SMILES: | C=CCCCCCCCCC(=O)OC(C)(C)C |
Complexity: | 214 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 11 |
XLogP3: | 5.2 |
Tert-Butyl undec-10-enoate is a versatile compound frequently utilized in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the production of various organic compounds and is particularly favored for its role in the synthesis of fragrances, pharmaceuticals, and agrochemicals. Its high stability and ease of manipulation make it an ideal choice for chemists seeking to introduce bulky tert-butyl and unsaturated functionalities into their target molecules. Additionally, tert-Butyl undec-10-enoate can be efficiently transformed into a diverse array of derivatives through straightforward chemical reactions, expanding its utility in the creation of complex molecular structures. Chemists rely on this compound as a key component in their synthetic toolbox, enabling the efficient and controlled construction of intricate organic molecules for a wide range of applications.