AB67538
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $29.00 | $20.00 | - + | |
1g | 95% | in stock | $38.00 | $27.00 | - + | |
5g | 95% | in stock | $150.00 | $105.00 | - + | |
10g | 95% | in stock | $298.00 | $209.00 | - + | |
25g | 95% | in stock | $728.00 | $510.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67538 |
Chemical Name: | (R)-4-Fluorophenylglycine |
CAS Number: | 93939-74-3 |
Molecular Formula: | C8H8FNO2 |
Molecular Weight: | 169.1530 |
MDL Number: | MFCD00042727 |
SMILES: | N[C@H](c1ccc(cc1)F)C(=O)O |
Complexity: | 166 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | -1.6 |
Chembiochem : a European journal of chemical biology 20031107