AI69061
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $23.00 | $17.00 | - + | |
250mg | 98% | in stock | $29.00 | $20.00 | - + | |
1g | 98% | in stock | $59.00 | $41.00 | - + | |
5g | 98% | in stock | $270.00 | $189.00 | - + | |
25g | 98% | in stock | $1,040.00 | $728.00 | - + | |
100g | 95% | in stock | $3,869.00 | $2,708.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI69061 |
Chemical Name: | Fmoc-N-methyl-L-cysteine(Trt) |
CAS Number: | 944797-51-7 |
Molecular Formula: | C38H33NO4S |
Molecular Weight: | 599.7379 |
MDL Number: | MFCD11973909 |
SMILES: | OC(=O)[C@@H](N(C(=O)OCC1c2ccccc2c2c1cccc2)C)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
FMoc-N-Me-Cys(Trt)-OH is a valuable building block in chemical synthesis, specifically in peptide synthesis. This compound serves as a protected form of N-methyl cysteine, providing a versatile starting material for the creation of complex peptides and proteins.By utilizing FMoc-N-Me-Cys(Trt)-OH in peptide synthesis, chemists can introduce N-methyl cysteine residues into the peptide chain while protecting the amino and thiol groups. This protection strategy allows for selective deprotection and manipulation of specific regions of the peptide, enabling the stepwise assembly of the desired sequence with high precision and control.The Trityl (Trt) protecting group on the cysteine thiol ensures its stability during the synthesis process, preventing undesired reactions and side products. This protection strategy is crucial for maintaining the integrity of the peptide sequence and facilitating the efficient formation of peptide bonds between the N-methyl cysteine residue and neighboring amino acids.Overall, FMoc-N-Me-Cys(Trt)-OH plays a crucial role in the synthesis of peptides with unique structural and functional properties, making it an essential tool for chemists in the field of peptide chemistry and drug development.