AB77244
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $20.00 | $14.00 | - + | |
25g | 95% | in stock | $31.00 | $22.00 | - + | |
100g | 95% | in stock | $77.00 | $54.00 | - + | |
500g | 95% | in stock | $231.00 | $162.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77244 |
Chemical Name: | N-Cyclohexyl-2-benzothiazolesulfenamide |
CAS Number: | 95-33-0 |
Molecular Formula: | C13H16N2S2 |
Molecular Weight: | 264.4095 |
MDL Number: | MFCD00022872 |
SMILES: | C1CCC(CC1)NSc1nc2c(s1)cccc2 |
NSC Number: | 4809 |
Complexity: | 244 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 4.4 |
Environmental toxicology and chemistry 20110801
Drug and chemical toxicology 20070101
Food additives and contaminants 20030201