AC70229
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $22.00 | $15.00 | - + | |
25g | 95% | in stock | $42.00 | $30.00 | - + | |
100g | 95% | in stock | $74.00 | $52.00 | - + | |
500g | 95% | in stock | $299.00 | $209.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC70229 |
Chemical Name: | 4-Hydroxy-4'-isopropoxydiphenylsulfone |
CAS Number: | 95235-30-6 |
Molecular Formula: | C15H16O4S |
Molecular Weight: | 292.3501 |
MDL Number: | MFCD01861244 |
SMILES: | CC(Oc1ccc(cc1)S(=O)(=O)c1ccc(cc1)O)C |
Complexity: | 383 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3 |
Environmental toxicology and chemistry 20071101