AB53140
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 95% | in stock | $81.00 | $57.00 | - + | |
10mg | 95% | in stock | $126.00 | $89.00 | - + | |
100mg | 95% | in stock | $198.00 | $138.00 | - + | |
250mg | 95% | in stock | $387.00 | $271.00 | - + | |
1g | 95% | in stock | $946.00 | $662.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53140 |
Chemical Name: | 2-(2-Chlorophenyl)-4-methyl-5-(pyridin-2-ylmethyl)-1H-pyrazolo[4,3-c]pyridine-3,6(2H,5H)-dione |
CAS Number: | 955272-06-7 |
Molecular Formula: | C19H15ClN4O2 |
Molecular Weight: | 366.801 |
MDL Number: | MFCD09961532 |
SMILES: | Clc1ccccc1n1[nH]c2c(c1=O)c(C)n(c(=O)c2)Cc1ccccn1 |
Complexity: | 675 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.3 |
Arteriosclerosis, thrombosis, and vascular biology 20140801
Clinical science (London, England : 1979) 20130201
PloS one 20110101
American journal of physiology. Renal physiology 20101201
Journal of medicinal chemistry 20101111