AX51327
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $240.00 | $168.00 | - + | |
10mg | 98% | in stock | $405.00 | $284.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX51327 |
Chemical Name: | Sm-164 |
CAS Number: | 957135-43-2 |
Molecular Formula: | C62H84N14O6 |
Molecular Weight: | 1121.4206 |
MDL Number: | MFCD28167763 |
SMILES: | CNC(C(=O)NC1CCCCC2N(C1=O)C(CC2)C(=O)NC(c1nnn(c1)CCCCc1ccc(cc1)CCCCn1nnc(c1)C(c1ccccc1)NC(=O)C1CCC2N1C(=O)C(CCCC2)NC(=O)C(NC)C)c1ccccc1)C |
Complexity: | 1930 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 10 |
Heavy Atom Count: | 82 |
Hydrogen Bond Acceptor Count: | 12 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 24 |
XLogP3: | 5.8 |
Bioorganic & medicinal chemistry letters 20130801
Bioorganic & medicinal chemistry 20121115
Breast cancer research and treatment 20120501
Cancer research 20120301
Molecular cancer therapeutics 20110401