AX18069
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $79.00 | $55.00 | - + | |
10mg | 98% | in stock | $80.00 | $56.00 | - + | |
25mg | 98% | in stock | $136.00 | $95.00 | - + | |
50mg | 98% | in stock | $230.00 | $161.00 | - + | |
100mg | 98% | in stock | $389.00 | $273.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX18069 |
Chemical Name: | Bay-K-8644 (S)-(-)- |
CAS Number: | 98625-26-4 |
Molecular Formula: | C16H15F3N2O4 |
Molecular Weight: | 356.2965 |
MDL Number: | MFCD00153769 |
SMILES: | COC(=O)C1=C(C)NC(=C([C@H]1c1ccccc1C(F)(F)F)[N+](=O)[O-])C |
Complexity: | 634 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.4 |
Journal of medicinal chemistry 20100722
Bioorganic & medicinal chemistry 20081015
Journal of medicinal chemistry 19960719