AB69734
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $7.00 | $5.00 | - + | |
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $74.00 | $52.00 | - + | |
25g | 97% | in stock | $165.00 | $116.00 | - + | |
100g | 98% | in stock | $573.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69734 |
Chemical Name: | 6-Bromo-4-hydroxyquinoline-3-carboxylic acid |
CAS Number: | 98948-95-9 |
Molecular Formula: | C10H6BrNO3 |
Molecular Weight: | 268.0635 |
MDL Number: | MFCD01569278 |
SMILES: | Brc1ccc2c(c1)c(O)c(cn2)C(=O)O |
Complexity: | 340 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.5 |
Journal of medicinal chemistry 20061102