AB43257
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 98% | in stock | $7.00 | $5.00 | - + | |
10g | 98% | in stock | $9.00 | $6.00 | - + | |
25g | 98% | in stock | $15.00 | $11.00 | - + | |
100g | ≥95% | in stock | $55.00 | $38.00 | - + | |
500g | 98% | in stock | $213.00 | $149.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43257 |
Chemical Name: | 1-Boc-3-piperidone |
CAS Number: | 98977-36-7 |
Molecular Formula: | C10H17NO3 |
Molecular Weight: | 199.2469 |
MDL Number: | MFCD01631193 |
SMILES: | O=C1CCCN(C1)C(=O)OC(C)(C)C |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 1 |
Journal of medicinal chemistry 20120322