AB52841
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $6.00 | $4.00 | - + | |
1g | 98 | in stock | $15.00 | $10.00 | - + | |
5g | 98 | in stock | $18.00 | $12.00 | - + | |
25g | 98% | in stock | $34.00 | $24.00 | - + | |
100g | 98% | in stock | $100.00 | $70.00 | - + | |
500g | 98% | in stock | $204.00 | $143.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52841 |
Chemical Name: | D-(+)-Trehalose |
CAS Number: | 99-20-7 |
Molecular Formula: | C12H22O11 |
Molecular Weight: | 342.2965 |
MDL Number: | MFCD00006628 |
SMILES: | OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
Complexity: | 348 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 10 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 11 |
Hydrogen Bond Donor Count: | 8 |
Rotatable Bond Count: | 4 |
XLogP3: | -4.2 |
α-D-Glucopyranoside, also known as α-D-glucopyranosyl, plays a crucial role in chemical synthesis as a key building block for creating a wide range of complex carbohydrates and glycosides. This versatile compound is utilized in various chemical reactions to introduce glucose moieties into different molecules, enabling the synthesis of bioactive compounds, pharmaceuticals, and natural products. With its ability to facilitate glycosylation reactions, α-D-glucopyranoside proves to be an indispensable tool for researchers and chemists working in the field of carbohydrate chemistry. Its applications extend to the development of new drugs, materials, and functionalized molecules, highlighting its significance as a fundamental component in organic synthesis.