AB61396
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | >98.0%(GC) | in stock | $18.00 | $12.00 | - + | |
25g | >98.0%(GC) | in stock | $39.00 | $27.00 | - + | |
100g | 98% | in stock | $106.00 | $75.00 | - + | |
500g | 98% | in stock | $387.00 | $271.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB61396 |
Chemical Name: | 2-Bromo-4'-nitroacetophenone |
CAS Number: | 99-81-0 |
Molecular Formula: | C8H6BrNO3 |
Molecular Weight: | 244.0421 |
MDL Number: | MFCD00007356 |
SMILES: | BrCC(=O)c1ccc(cc1)[N+](=O)[O-] |
NSC Number: | 9805 |
Complexity: | 206 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.3 |
Acta crystallographica. Section E, Structure reports online 20120801
Journal of medicinal chemistry 20110623
Marine biotechnology (New York, N.Y.) 20101001
Molecules (Basel, Switzerland) 20070418
Journal of medicinal chemistry 20031023
Bioorganic & medicinal chemistry letters 20021104
Applied and environmental microbiology 20010201