logo
Home  > Piperazine-1,4-bis(ethanesulfonic acid) monosodium salt hydrate

AA01013

10010-67-0 | Piperazine-1,4-bis(ethanesulfonic acid) monosodium salt hydrate

Packsize Purity Availability Price Discounted Price    Quantity
5g 95% in stock $15.00 $11.00 -   +
25g 95% in stock $41.00 $29.00 -   +
100g 95% in stock $51.00 $36.00 -   +
500g 95% in stock $91.00 $64.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA01013
Chemical Name: Piperazine-1,4-bis(ethanesulfonic acid) monosodium salt hydrate
CAS Number: 10010-67-0
Molecular Formula: C8H17N2NaO6S2
Molecular Weight: 324.3502
MDL Number: MFCD00065472
SMILES: [O-]S(=O)(=O)CCN1CCN(CC1)CCS(=O)(=O)O.[Na+]

 

Computed Properties
Complexity: 447  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 19  
Hydrogen Bond Acceptor Count: 8  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 6  

 

 

Upstream Synthesis Route
  • Sodium 2-(4-(2-sulfoethyl)piperazin-1-yl)ethanesulfonate is a versatile compound widely used in chemical synthesis as a key reagent for various reactions. Its unique structure allows it to participate in reactions such as nucleophilic substitution, where the sulfonate group acts as a leaving group, enabling the attachment of different functional groups to the piperazine moiety. This compound is particularly valuable in the synthesis of pharmaceuticals and fine chemicals due to its ability to introduce specific functionalities in a controlled manner. Additionally, the presence of the sulfonate group enhances the compound's water solubility, making it suitable for aqueous-based reactions and applications.
FEATURED PRODUCTS