logo
Home  > 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide

AA01877

100313-81-3 | 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $142.00 $100.00 -   +
250mg 95% in stock $240.00 $168.00 -   +
1g 95% in stock $647.00 $453.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA01877
Chemical Name: 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide
CAS Number: 100313-81-3
Molecular Formula: C8H11ClN2O2S
Molecular Weight: 234.7031
MDL Number: MFCD02704404
SMILES: Clc1ccc(cc1N)S(=O)(=O)N(C)C

 

Upstream Synthesis Route 
  • 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide is a highly versatile compound that finds significant applications in chemical synthesis processes. This compound serves as a key building block in the creation of a wide range of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structural properties make it a valuable intermediate in the synthesis of various heterocyclic compounds and complex organic molecules. Additionally, 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide is commonly utilized in the development of new materials with specific functional properties, highlighting its importance in the field of material science and polymer chemistry. Its reactivity and functional groups make it an essential component in the production of innovative chemical products with diverse applications.In chemical synthesis, 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide serves as a crucial reagent for the introduction of amino and chloro functionalities into target molecules. These reactive groups enable the selective modification of organic compounds, facilitating the synthesis of structurally complex and biologically active molecules. The presence of the sulfonamide moiety in its structure further enhances its utility as a precursor for the synthesis of sulfonamides, a class of compounds widely used in medicinal chemistry for their antimicrobial and anticancer properties. By incorporating 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide into chemical reactions, chemists can access a diverse array of chemical transformations, ultimately leading to the production of valuable compounds with tailored properties and functionalities.
FEATURED PRODUCTS