AA03860
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 98% | in stock | $9.00 | $6.00 | - + | |
10g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $38.00 | $27.00 | - + | |
100g | 98% | in stock | $135.00 | $95.00 | - + | |
500g | 98% | in stock | $667.00 | $467.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA03860 |
Chemical Name: | 4-Fluoro-3-nitrobenzonitrile |
CAS Number: | 1009-35-4 |
Molecular Formula: | C7H3FN2O2 |
Molecular Weight: | 166.1093 |
MDL Number: | MFCD01632197 |
SMILES: | N#Cc1ccc(c(c1)[N+](=O)[O-])F |
Complexity: | 229 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 1.6 |
Journal of the American Chemical Society 20030219