AA05979
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $16.00 | $11.00 | - + | |
250mg | 95% | in stock | $19.00 | $13.00 | - + | |
1g | 95% | in stock | $32.00 | $23.00 | - + | |
5g | 95% | in stock | $102.00 | $71.00 | - + | |
25g | 95% | in stock | $345.00 | $242.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA05979 |
Chemical Name: | Boc-D-beta-homoproline |
CAS Number: | 101555-60-6 |
Molecular Formula: | C11H19NO4 |
Molecular Weight: | 229.27286000000012 |
MDL Number: | MFCD06202402 |
SMILES: | OC(=O)C[C@H]1CCCN1C(=O)OC(C)(C)C |
The (R)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)acetic acid, also known as $name$, serves as a key building block in chemical synthesis. Its unique structure and properties make it a valuable tool in organic chemistry, particularly in the creation of complex molecules and pharmaceutical compounds.In chemical synthesis, $name$ is often utilized as a chiral auxiliary, helping to control the stereochemistry of reactions. Its pyrrolidine ring provides steric hindrance and can influence the outcome of stereoselective transformations. By incorporating (R)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)acetic acid into a synthetic pathway, chemists can access enantiomerically pure compounds with precise control over the configuration at specific stereocenters.Additionally, $name$ can be employed as a protecting group for amines, shielding their reactivity during various synthetic steps. The tert-butoxycarbonyl (Boc) moiety can be selectively removed under mild conditions, allowing for further functionalization of the molecule. This protective group strategy enables chemists to manipulate the reactivity of amine functionalities strategically, facilitating the construction of complex molecular architectures.Overall, the versatility and utility of (R)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)acetic acid make it a valuable asset in chemical synthesis, empowering chemists to design and assemble intricate molecules with precision and efficiency.