AA06797
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $26.00 | $18.00 | - + | |
250mg | 98% | in stock | $39.00 | $27.00 | - + | |
1g | 98% | in stock | $99.00 | $69.00 | - + | |
5g | 98% | in stock | $346.00 | $243.00 | - + | |
10g | 98% | in stock | $624.00 | $437.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA06797 |
Chemical Name: | (S)-2-((tert-Butoxycarbonyl)(methyl)amino)butanoic acid |
CAS Number: | 101759-74-4 |
Molecular Formula: | C10H19NO4 |
Molecular Weight: | 217.2622 |
MDL Number: | MFCD05264091 |
SMILES: | CC[C@@H](C(=O)O)NCC(=O)OC(C)(C)C |
(S)-2-((tert-Butoxycarbonyl)(methyl)amino)butanoic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. Its unique structure allows for precise manipulation and control in the synthesis of various compounds. This compound is widely used in peptide chemistry, specifically in the protection of amino groups during peptide assembly.$name$ is utilized as a protecting group for the amino group, safeguarding it from undesired reactions while other functional groups are being manipulated. This protection strategy ensures selective reactions at specific sites within a molecule, enabling the synthesis of complex peptides and pharmaceuticals with high purity and efficiency.In addition to its role as a protecting group, $name$ can also serve as a chiral auxiliary in asymmetric synthesis. By leveraging the chiral properties of $name$, chemists can induce chirality in target molecules during their synthesis, leading to the production of enantiomerically pure compounds.Overall, the application of (S)-2-((tert-Butoxycarbonyl)(methyl)amino)butanoic acid in chemical synthesis facilitates precise control over reaction pathways, enabling the synthesis of intricate compounds with desired stereochemistry and functionality.