AA07366
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $74.00 | $52.00 | - + | |
250mg | 95% | in stock | $123.00 | $87.00 | - + | |
1g | 95% | in stock | $353.00 | $248.00 | - + | |
5g | 95% | in stock | $1,591.00 | $1,114.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07366 |
Chemical Name: | (R)-2-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)-4-methylpentanoic acid |
CAS Number: | 1018899-99-4 |
Molecular Formula: | C22H25NO4 |
Molecular Weight: | 367.4382 |
MDL Number: | MFCD07372889 |
SMILES: | CC(C[C@@H](C(=O)O)CNC(=O)OCC1c2ccccc2-c2c1cccc2)C |
Complexity: | 498 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.3 |
The (R)-2-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)-4-methylpentanoic acid is a versatile compound widely utilized in chemical synthesis due to its unique properties. In organic synthesis, this particular compound is commonly employed as a chiral building block to introduce asymmetry into molecular structures. Its chiral nature allows for the creation of enantiomerically pure compounds, which is crucial in pharmaceutical and agrochemical industries where stereochemistry plays a significant role in biological activity. With its distinct structure and functional groups, (R)-2-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)-4-methylpentanoic acid serves as a key component in the development of complex molecules and the synthesis of novel chemical entities.