AA09726
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $155.00 | $108.00 | - + | |
2.5g | 95% | in stock | $322.00 | $225.00 | - + | |
5g | 95% | in stock | $511.00 | $358.00 | - + | |
10g | 95% | in stock | $830.00 | $581.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09726 |
Chemical Name: | 4-[(Methylamino)sulfonyl]benzoic acid |
CAS Number: | 10252-63-8 |
Molecular Formula: | C8H9NO4S |
Molecular Weight: | 215.2264 |
MDL Number: | MFCD05804382 |
SMILES: | CNS(=O)(=O)c1ccc(cc1)C(=O)O |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.8 |
Journal of medicinal chemistry 19971205