AA12529
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% 99%ee | in stock | $6.00 | $4.00 | - + | |
5g | 98% 99%ee | in stock | $11.00 | $8.00 | - + | |
10g | 98% 99%ee | in stock | $16.00 | $11.00 | - + | |
25g | 98% 99%ee | in stock | $34.00 | $24.00 | - + | |
100g | 98% 99%ee | in stock | $117.00 | $82.00 | - + | |
500g | 98% 99%ee | in stock | $410.00 | $287.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA12529 |
Chemical Name: | (2R)-(-)-Glycidyl tosylate |
CAS Number: | 113826-06-5 |
Molecular Formula: | C10H12O4S |
Molecular Weight: | 228.2649 |
MDL Number: | MFCD00010834 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)OC[C@@H]1OC1 |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.1 |
Electrophoresis 20081101
Analytica chimica acta 20080616
Journal of the American Chemical Society 20051221
Enantiomer 20020101