AA19735
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $6.00 | $4.00 | - + | |
250mg | 95% | in stock | $12.00 | $9.00 | - + | |
1g | 95% | in stock | $26.00 | $18.00 | - + | |
5g | 95% | in stock | $36.00 | $25.00 | - + | |
10g | 95% | in stock | $43.00 | $30.00 | - + | |
25g | 95% | in stock | $101.00 | $71.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19735 |
Chemical Name: | Boc-3-fluoro-d-phenylalanine |
CAS Number: | 114873-11-9 |
Molecular Formula: | C14H18FNO4 |
Molecular Weight: | 283.2954 |
MDL Number: | MFCD00672523 |
SMILES: | O=C(OC(C)(C)C)N[C@@H](C(=O)O)Cc1cccc(c1)F |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.6 |
British journal of haematology 20090301