logo
Home  > 2,7-Phenazinediamine

AD74743

120209-97-4 | 2,7-Phenazinediamine

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD74743
Chemical Name: 2,7-Phenazinediamine
CAS Number: 120209-97-4
Molecular Formula: C12H10N4
Molecular Weight: 210.2346
MDL Number: MFCD01708512
SMILES: Nc1ccc2c(c1)nc1c(n2)cc(cc1)N

 

Upstream Synthesis Route 
  • 2,7-Diaminophenazine is a versatile compound commonly utilized in chemical synthesis as a key intermediate for the production of various organic molecules and materials. This chemical is known for its ability to undergo various reactions, such as oxidative coupling, nucleophilic substitution, and cyclization, making it a valuable building block in the pharmaceutical, materials science, and agrochemical industries. In organic synthesis, 2,7-Diaminophenazine can be used as a precursor for the synthesis of heterocyclic compounds, dyes, and complex organic structures. Additionally, its unique nitrogen-containing structure allows for the introduction of functional groups that impart specific properties to the final products. Its applications extend to the development of novel compounds with potential biological activities, such as anti-cancer agents, antimicrobial agents, and organic semiconductors in optoelectronic devices. This compound's versatility and reactivity make it an essential component in the toolkit of synthetic chemists seeking to design and prepare advanced organic molecules with desired properties and functions.
FEATURED PRODUCTS