logo
Home  > 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]amino}sulfonyl)-N,N-dimethylpyridine-3-carboxamide

AD77892

111991-09-4 | 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]amino}sulfonyl)-N,N-dimethylpyridine-3-carboxamide

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $34.00 $24.00 -   +
5g 95% in stock $65.00 $45.00 -   +
10g 95% in stock $106.00 $75.00 -   +
25g 95% in stock $171.00 $120.00 -   +
100g 95% in stock $403.00 $282.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD77892
Chemical Name: 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]amino}sulfonyl)-N,N-dimethylpyridine-3-carboxamide
CAS Number: 111991-09-4
Molecular Formula: C15H18N6O6S
Molecular Weight: 410.405
MDL Number: MFCD00203303
SMILES: COc1cc(OC)nc(n1)NC(=O)NS(=O)(=O)c1ncccc1C(=O)N(C)C

 

Computed Properties
Complexity: 642  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 28  
Hydrogen Bond Acceptor Count: 9  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 6  
XLogP3: 0.6  

 

 

Upstream Synthesis Route 
  • 2-(N-((4,6-Dimethoxypyrimidin-2-yl)carbamoyl)sulfamoyl)-N,N-dimethylnicotinamide serves as a versatile reagent in chemical synthesis due to its unique properties and molecular structure. This compound is commonly used as a key building block in the synthesis of various pharmaceutical compounds and agrochemicals. Its precise chemical structure allows for the controlled modification and functionalization of complex molecules, making it a valuable tool in organic chemistry research and development. Additionally, its sulfamoyl and carbamoyl functional groups enable specific interactions with target molecules, enhancing selectivity and efficacy in synthetic pathways.
Literature
FEATURED PRODUCTS